About 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid
4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid (PubChem CID 44521970) has the molecular formula C21H25ClN2O5
and a molecular weight of 420.89 g/mol. Its IUPAC name is 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid.
Molecular Properties
| Compound Name | 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid |
| PubChem CID | 44521970 |
| Molecular Formula | C21H25ClN2O5 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid |
| SMILES | Cc1cccc(N2CCN(Cc3cc(Cl)ccc3O)CC2)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H23ClN2O.C2H2O4/c1-14-4-3-5-18(15(14)2)22-10-8-21(9-11-22)13-16-12-17(20)6-7-19(16)23;3-1(4)2(5)6/h3-7,12,23H,8-11,13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | KHLTXABIIURFDK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid?
The IUPAC name of 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid (CID 44521970) is 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid.
What is the SMILES notation for 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid?
The canonical SMILES for 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid is Cc1cccc(N2CCN(Cc3cc(Cl)ccc3O)CC2)c1C.O=C(O)C(=O)O.
What is the InChIKey of 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid?
The InChIKey is KHLTXABIIURFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClN2O.C2H2O4/c1-14-4-3-5-18(15(14)2)22-10-8-21(9-11-22)13-16-12-17(20)6-7-19(16)23;3-1(4)2(5)6/h3-7,12,23H,8-11,13H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid?
4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid has a molecular weight of 420.89 g/mol, XLogP of 3.14, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol;oxalic acid is sourced from PubChem (CID 44521970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).