About 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one
3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one (PubChem CID 44522035) has the molecular formula C24H23NO3S
and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one.
Molecular Properties
| Compound Name | 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one |
| PubChem CID | 44522035 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one |
| SMILES | CCCCCCc1ncc(-c2cc3cc(O)c(-c4ccccc4)cc3oc2=O)s1 |
| InChI | InChI=1S/C24H23NO3S/c1-2-3-4-8-11-23-25-15-22(29-23)19-12-17-13-20(26)18(14-21(17)28-24(19)27)16-9-6-5-7-10-16/h5-7,9-10,12-15,26H,2-4,8,11H2,1H3 |
| InChIKey | ALNVBUHEXXHOFC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one?
The IUPAC name of 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one (CID 44522035) is 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one.
What is the SMILES notation for 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one?
The canonical SMILES for 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one is CCCCCCc1ncc(-c2cc3cc(O)c(-c4ccccc4)cc3oc2=O)s1.
What is the InChIKey of 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one?
The InChIKey is ALNVBUHEXXHOFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO3S/c1-2-3-4-8-11-23-25-15-22(29-23)19-12-17-13-20(26)18(14-21(17)28-24(19)27)16-9-6-5-7-10-16/h5-7,9-10,12-15,26H,2-4,8,11H2,1H3.
What are the key properties of 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one?
3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one has a molecular weight of 405.52 g/mol, XLogP of 6.41, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hexyl-1,3-thiazol-5-yl)-6-hydroxy-7-phenylchromen-2-one is sourced from PubChem (CID 44522035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).