C18H16Cl2F3N7 — CID 44522056
2-N-[(2-chlorophenyl)methylideneamino]-6-N-methyl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine;hydrochloride (PubChem CID 44522056) has the molecular formula C18H16Cl2F3N7 and a molecular weight of 458.28 g/mol. Its IUPAC name is 2-N-[(2-chlorophenyl)methylideneamino]-6-N-methyl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine;hydrochloride.
| Compound Name | 2-N-[(2-chlorophenyl)methylideneamino]-6-N-methyl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine;hydrochloride |
|---|---|
| PubChem CID | 44522056 |
| Molecular Formula | C18H16Cl2F3N7 |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-N-[(2-chlorophenyl)methylideneamino]-6-N-methyl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine;hydrochloride |
| SMILES | CNc1nc(NN=Cc2ccccc2Cl)nc(Nc2cccc(C(F)(F)F)c2)n1.Cl |
| InChI | InChI=1S/C18H15ClF3N7.ClH/c1-23-15-26-16(25-13-7-4-6-12(9-13)18(20,21)22)28-17(27-15)29-24-10-11-5-2-3-8-14(11)19;/h2-10H,1H3,(H3,23,25,26,27,28,29);1H |
| InChIKey | KTJKPECJQYPFOD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|