About 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol
2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol (PubChem CID 44522104) has the molecular formula C19H22F2N2O2
and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol.
Molecular Properties
| Compound Name | 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol |
| PubChem CID | 44522104 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CN2CCCC(Nc3ccc(F)c(F)c3)C2)c(O)c1 |
| InChI | InChI=1S/C19H22F2N2O2/c1-25-16-6-4-13(19(24)10-16)11-23-8-2-3-15(12-23)22-14-5-7-17(20)18(21)9-14/h4-7,9-10,15,22,24H,2-3,8,11-12H2,1H3 |
| InChIKey | VBNASNOQRHFFDQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol?
The IUPAC name of 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol (CID 44522104) is 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol.
What is the SMILES notation for 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol?
The canonical SMILES for 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol is COc1ccc(CN2CCCC(Nc3ccc(F)c(F)c3)C2)c(O)c1.
What is the InChIKey of 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol?
The InChIKey is VBNASNOQRHFFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F2N2O2/c1-25-16-6-4-13(19(24)10-16)11-23-8-2-3-15(12-23)22-14-5-7-17(20)18(21)9-14/h4-7,9-10,15,22,24H,2-3,8,11-12H2,1H3.
What are the key properties of 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol?
2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol has a molecular weight of 348.39 g/mol, XLogP of 3.76, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-5-methoxyphenol is sourced from PubChem (CID 44522104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).