About 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide
3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide (PubChem CID 44522208) has the molecular formula C23H31N3O2
and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide |
| PubChem CID | 44522208 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCN(CC3(c4ccccc4)CCCCC3)CC2)on1 |
| InChI | InChI=1S/C23H31N3O2/c1-18-16-21(28-25-18)22(27)24-20-10-14-26(15-11-20)17-23(12-6-3-7-13-23)19-8-4-2-5-9-19/h2,4-5,8-9,16,20H,3,6-7,10-15,17H2,1H3,(H,24,27) |
| InChIKey | GKRUCAPEKRRFCW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide (CID 44522208) is 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide is Cc1cc(C(=O)NC2CCN(CC3(c4ccccc4)CCCCC3)CC2)on1.
What is the InChIKey of 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide?
The InChIKey is GKRUCAPEKRRFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N3O2/c1-18-16-21(28-25-18)22(27)24-20-10-14-26(15-11-20)17-23(12-6-3-7-13-23)19-8-4-2-5-9-19/h2,4-5,8-9,16,20H,3,6-7,10-15,17H2,1H3,(H,24,27).
What are the key properties of 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide?
3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide has a molecular weight of 381.52 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[1-[(1-phenylcyclohexyl)methyl]piperidin-4-yl]-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 44522208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).