C23H28ClN3O4S — CID 44522274
N-(5-chloro-2-morpholin-4-ylphenyl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 44522274) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is N-(5-chloro-2-morpholin-4-ylphenyl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | N-(5-chloro-2-morpholin-4-ylphenyl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 44522274 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-(5-chloro-2-morpholin-4-ylphenyl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C=CC(=O)Nc2cc(Cl)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H28ClN3O4S/c1-3-27(4-2)32(29,30)20-9-5-18(6-10-20)7-12-23(28)25-21-17-19(24)8-11-22(21)26-13-15-31-16-14-26/h5-12,17H,3-4,13-16H2,1-2H3,(H,25,28) |
| InChIKey | SKBWECDJQKPQPX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|