About N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride
N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride (PubChem CID 44522287) has the molecular formula C15H19Cl2FN2O
and a molecular weight of 333.23 g/mol. Its IUPAC name is N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride |
| PubChem CID | 44522287 |
| Molecular Formula | C15H19Cl2FN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride |
| SMILES | CNCCCNCc1ccc(-c2ccc(F)c(Cl)c2)o1.Cl |
| InChI | InChI=1S/C15H18ClFN2O.ClH/c1-18-7-2-8-19-10-12-4-6-15(20-12)11-3-5-14(17)13(16)9-11;/h3-6,9,18-19H,2,7-8,10H2,1H3;1H |
| InChIKey | UMWVOWQNJMVRDM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride?
The IUPAC name of N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride (CID 44522287) is N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride.
What is the SMILES notation for N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride?
The canonical SMILES for N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride is CNCCCNCc1ccc(-c2ccc(F)c(Cl)c2)o1.Cl.
What is the InChIKey of N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride?
The InChIKey is UMWVOWQNJMVRDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClFN2O.ClH/c1-18-7-2-8-19-10-12-4-6-15(20-12)11-3-5-14(17)13(16)9-11;/h3-6,9,18-19H,2,7-8,10H2,1H3;1H.
What are the key properties of N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride?
N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride has a molecular weight of 333.23 g/mol, XLogP of 3.86, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;hydrochloride is sourced from PubChem (CID 44522287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).