C16H21Cl2FN2O — CID 44522288
N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride (PubChem CID 44522288) has the molecular formula C16H21Cl2FN2O and a molecular weight of 347.26 g/mol. Its IUPAC name is N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride.
| Compound Name | N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 44522288 |
| Molecular Formula | C16H21Cl2FN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
| SMILES | CN(C)CCCNCc1ccc(-c2ccc(F)c(Cl)c2)o1.Cl |
| InChI | InChI=1S/C16H20ClFN2O.ClH/c1-20(2)9-3-8-19-11-13-5-7-16(21-13)12-4-6-15(18)14(17)10-12;/h4-7,10,19H,3,8-9,11H2,1-2H3;1H |
| InChIKey | ASKFMBPVRBLQOQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|