About 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide
2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide (PubChem CID 44522333) has the molecular formula C17H22ClN3OS
and a molecular weight of 351.90 g/mol. Its IUPAC name is 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide.
Molecular Properties
| Compound Name | 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide |
| PubChem CID | 44522333 |
| Molecular Formula | C17H22ClN3OS |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N(c1ccc(Cl)cc1)c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C17H22ClN3OS/c1-11(15(22)19-5)21(13-8-6-12(18)7-9-13)16-20-14(10-23-16)17(2,3)4/h6-11H,1-5H3,(H,19,22) |
| InChIKey | VKBSSYVTNIHZBW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide?
The IUPAC name of 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide (CID 44522333) is 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide.
What is the SMILES notation for 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide?
The canonical SMILES for 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide is CNC(=O)C(C)N(c1ccc(Cl)cc1)c1nc(C(C)(C)C)cs1.
What is the InChIKey of 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide?
The InChIKey is VKBSSYVTNIHZBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClN3OS/c1-11(15(22)19-5)21(13-8-6-12(18)7-9-13)16-20-14(10-23-16)17(2,3)4/h6-11H,1-5H3,(H,19,22).
What are the key properties of 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide?
2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide has a molecular weight of 351.90 g/mol, XLogP of 4.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-(4-tert-butyl-1,3-thiazol-2-yl)-4-chloroanilino)-N-methylpropanamide is sourced from PubChem (CID 44522333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).