C12H18ClN5 — CID 44522487
1-phenyl-2-propyl-2H-1,3,5-triazine-4,6-diamine;hydrochloride (PubChem CID 44522487) has the molecular formula C12H18ClN5 and a molecular weight of 267.76 g/mol. Its IUPAC name is 1-phenyl-2-propyl-2H-1,3,5-triazine-4,6-diamine;hydrochloride.
| Compound Name | 1-phenyl-2-propyl-2H-1,3,5-triazine-4,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 44522487 |
| Molecular Formula | C12H18ClN5 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-phenyl-2-propyl-2H-1,3,5-triazine-4,6-diamine;hydrochloride |
| SMILES | CCCC1N=C(N)N=C(N)N1c1ccccc1.Cl |
| InChI | InChI=1S/C12H17N5.ClH/c1-2-6-10-15-11(13)16-12(14)17(10)9-7-4-3-5-8-9;/h3-5,7-8,10H,2,6H2,1H3,(H4,13,14,15,16);1H |
| InChIKey | KZMILUKFPNLZGB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |