C11H15N5O — CID 44522565
2-methyl-1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine (PubChem CID 44522565) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is 2-methyl-1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 2-methyl-1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 44522565 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-methyl-1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine |
| SMILES | CC1N=C(N)N=C(N)N1OCc1ccccc1 |
| InChI | InChI=1S/C11H15N5O/c1-8-14-10(12)15-11(13)16(8)17-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H4,12,13,14,15) |
| InChIKey | WWTNGMCEVXYMLA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |