C37H47N3O7 — CID 44522629
benzyl (2S)-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]hexanoyl]amino]propanoate (PubChem CID 44522629) has the molecular formula C37H47N3O7 and a molecular weight of 645.80 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]hexanoyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 44522629 |
| Molecular Formula | C37H47N3O7 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]hexanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)c1ccc(-c2ccccc2)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H47N3O7/c1-26(33(42)45-25-27-15-9-7-10-16-27)39-32(41)31(19-13-14-24-38-34(43)46-36(2,3)4)40-35(44)47-37(5,6)30-22-20-29(21-23-30)28-17-11-8-12-18-28/h7-12,15-18,20-23,26,31H,13-14,19,24-25H2,1-6H3,(H,38,43)(H,39,41)(H,40,44)/t26-,31-/m0/s1 |
| InChIKey | CSJQTMFMACWLJR-HVNZXBJASA-N |
| XLogP | 6.63 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|