C31H41ClN2O3 — CID 44522654
2,2-dimethyl-7-pentyl-4-[1-(quinolin-3-ylmethyl)-3,6-dihydro-2H-pyridin-4-yl]-3,4-dihydrochromen-5-ol;hydrate;hydrochloride (PubChem CID 44522654) has the molecular formula C31H41ClN2O3 and a molecular weight of 525.13 g/mol. Its IUPAC name is 2,2-dimethyl-7-pentyl-4-[1-(quinolin-3-ylmethyl)-3,6-dihydro-2H-pyridin-4-yl]-3,4-dihydrochromen-5-ol;hydrate;hydrochloride.
| Compound Name | 2,2-dimethyl-7-pentyl-4-[1-(quinolin-3-ylmethyl)-3,6-dihydro-2H-pyridin-4-yl]-3,4-dihydrochromen-5-ol;hydrate;hydrochloride |
|---|---|
| PubChem CID | 44522654 |
| Molecular Formula | C31H41ClN2O3 |
| Molecular Weight | 525.13 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 2,2-dimethyl-7-pentyl-4-[1-(quinolin-3-ylmethyl)-3,6-dihydro-2H-pyridin-4-yl]-3,4-dihydrochromen-5-ol;hydrate;hydrochloride |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(C)CC2C1=CCN(Cc2cnc3ccccc3c2)CC1.Cl.O |
| InChI | InChI=1S/C31H38N2O2.ClH.H2O/c1-4-5-6-9-22-17-28(34)30-26(19-31(2,3)35-29(30)18-22)24-12-14-33(15-13-24)21-23-16-25-10-7-8-11-27(25)32-20-23;;/h7-8,10-12,16-18,20,26,34H,4-6,9,13-15,19,21H2,1-3H3;1H;1H2 |
| InChIKey | NIOAQRHKUCKVCS-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.13 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|