About 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride
4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride (PubChem CID 44522662) has the molecular formula C22H33ClN2O
and a molecular weight of 376.97 g/mol. Its IUPAC name is 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride |
| PubChem CID | 44522662 |
| Molecular Formula | C22H33ClN2O |
| Molecular Weight | 376.97 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride |
| SMILES | CCCN1CCC(CCCc2ccnc3ccc(O)cc23)[C@@H](CC)C1.Cl |
| InChI | InChI=1S/C22H32N2O.ClH/c1-3-13-24-14-11-18(17(4-2)16-24)6-5-7-19-10-12-23-22-9-8-20(25)15-21(19)22;/h8-10,12,15,17-18,25H,3-7,11,13-14,16H2,1-2H3;1H/t17-,18?;/m0./s1 |
| InChIKey | MLGNGDIYMKNRGB-OQICONIUSA-N |
| XLogP | 5.44 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride?
The IUPAC name of 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride (CID 44522662) is 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride.
What is the SMILES notation for 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride?
The canonical SMILES for 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride is CCCN1CCC(CCCc2ccnc3ccc(O)cc23)[C@@H](CC)C1.Cl.
What is the InChIKey of 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride?
The InChIKey is MLGNGDIYMKNRGB-OQICONIUSA-N. The full InChI is InChI=1S/C22H32N2O.ClH/c1-3-13-24-14-11-18(17(4-2)16-24)6-5-7-19-10-12-23-22-9-8-20(25)15-21(19)22;/h8-10,12,15,17-18,25H,3-7,11,13-14,16H2,1-2H3;1H/t17-,18?;/m0./s1.
What are the key properties of 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride?
4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride has a molecular weight of 376.97 g/mol, XLogP of 5.44, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(3R,4R)-3-ethyl-1-propylpiperidin-4-yl]propyl]quinolin-6-ol;hydrochloride is sourced from PubChem (CID 44522662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).