About (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate
(E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate (PubChem CID 44522666) has the molecular formula C31H31NO7
and a molecular weight of 529.59 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate |
| PubChem CID | 44522666 |
| Molecular Formula | C31H31NO7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(C)NCC(O)c2ccc3ccc4ccccc4c3c2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C27H27NO3.C4H4O4/c1-18(15-19-7-9-22(10-8-19)27(30)31-2)28-17-26(29)23-14-13-21-12-11-20-5-3-4-6-24(20)25(21)16-23;5-3(6)1-2-4(7)8/h3-14,16,18,26,28-29H,15,17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | NHBSJYLINJDKSI-WLHGVMLRSA-N |
| XLogP | 4.75 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate?
The IUPAC name of (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate (CID 44522666) is (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate.
What is the SMILES notation for (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate?
The canonical SMILES for (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate is COC(=O)c1ccc(CC(C)NCC(O)c2ccc3ccc4ccccc4c3c2)cc1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate?
The InChIKey is NHBSJYLINJDKSI-WLHGVMLRSA-N. The full InChI is InChI=1S/C27H27NO3.C4H4O4/c1-18(15-19-7-9-22(10-8-19)27(30)31-2)28-17-26(29)23-14-13-21-12-11-20-5-3-4-6-24(20)25(21)16-23;5-3(6)1-2-4(7)8/h3-14,16,18,26,28-29H,15,17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate?
(E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate has a molecular weight of 529.59 g/mol, XLogP of 4.75, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;methyl 4-[2-[(2-hydroxy-2-phenanthren-3-ylethyl)amino]propyl]benzoate is sourced from PubChem (CID 44522666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).