C38H42N2O7 — CID 44522712
[4-[3-[(3R,4R)-3-ethyl-1-(4-oxo-4-phenylbutyl)piperidin-4-yl]propyl]quinolin-6-yl] benzoate;oxalic acid (PubChem CID 44522712) has the molecular formula C38H42N2O7 and a molecular weight of 638.76 g/mol. Its IUPAC name is [4-[3-[(3R,4R)-3-ethyl-1-(4-oxo-4-phenylbutyl)piperidin-4-yl]propyl]quinolin-6-yl] benzoate;oxalic acid.
| Compound Name | [4-[3-[(3R,4R)-3-ethyl-1-(4-oxo-4-phenylbutyl)piperidin-4-yl]propyl]quinolin-6-yl] benzoate;oxalic acid |
|---|---|
| PubChem CID | 44522712 |
| Molecular Formula | C38H42N2O7 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | [4-[3-[(3R,4R)-3-ethyl-1-(4-oxo-4-phenylbutyl)piperidin-4-yl]propyl]quinolin-6-yl] benzoate;oxalic acid |
| SMILES | CC[C@H]1CN(CCCC(=O)c2ccccc2)CC[C@H]1CCCc1ccnc2ccc(OC(=O)c3ccccc3)cc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C36H40N2O3.C2H2O4/c1-2-27-26-38(23-10-17-35(39)30-11-5-3-6-12-30)24-21-28(27)15-9-16-29-20-22-37-34-19-18-32(25-33(29)34)41-36(40)31-13-7-4-8-14-31;3-1(4)2(5)6/h3-8,11-14,18-20,22,25,27-28H,2,9-10,15-17,21,23-24,26H2,1H3;(H,3,4)(H,5,6)/t27-,28+;/m0./s1 |
| InChIKey | VUAYKHAHXZSEEH-DUZWKJOOSA-N |
| XLogP | 6.94 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|