About methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide
methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide (PubChem CID 44522726) has the molecular formula C20H23BrF3NO4
and a molecular weight of 478.31 g/mol. Its IUPAC name is methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide.
Molecular Properties
| Compound Name | methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide |
| PubChem CID | 44522726 |
| Molecular Formula | C20H23BrF3NO4 |
| Molecular Weight | 478.31 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide |
| SMILES | Br.COC(=O)c1ccc(CC(C)NCC(O)c2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H22F3NO4.BrH/c1-13(10-14-6-8-15(9-7-14)19(26)27-2)24-12-18(25)16-4-3-5-17(11-16)28-20(21,22)23;/h3-9,11,13,18,24-25H,10,12H2,1-2H3;1H |
| InChIKey | VNDLZWHTEJXLAM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide?
The IUPAC name of methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide (CID 44522726) is methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide.
What is the SMILES notation for methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide?
The canonical SMILES for methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide is Br.COC(=O)c1ccc(CC(C)NCC(O)c2cccc(OC(F)(F)F)c2)cc1.
What is the InChIKey of methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide?
The InChIKey is VNDLZWHTEJXLAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F3NO4.BrH/c1-13(10-14-6-8-15(9-7-14)19(26)27-2)24-12-18(25)16-4-3-5-17(11-16)28-20(21,22)23;/h3-9,11,13,18,24-25H,10,12H2,1-2H3;1H.
What are the key properties of methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide?
methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide has a molecular weight of 478.31 g/mol, XLogP of 4.20, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[[2-hydroxy-2-[3-(trifluoromethoxy)phenyl]ethyl]amino]propyl]benzoate;hydrobromide is sourced from PubChem (CID 44522726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).