C24H36Cl2N2O — CID 44522740
1-(3-chlorophenyl)-2-[1-[4-[6-(methylamino)hexyl]phenyl]propan-2-ylamino]ethanol;hydrochloride (PubChem CID 44522740) has the molecular formula C24H36Cl2N2O and a molecular weight of 439.47 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[1-[4-[6-(methylamino)hexyl]phenyl]propan-2-ylamino]ethanol;hydrochloride.
| Compound Name | 1-(3-chlorophenyl)-2-[1-[4-[6-(methylamino)hexyl]phenyl]propan-2-ylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 44522740 |
| Molecular Formula | C24H36Cl2N2O |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[1-[4-[6-(methylamino)hexyl]phenyl]propan-2-ylamino]ethanol;hydrochloride |
| SMILES | CNCCCCCCc1ccc(CC(C)NCC(O)c2cccc(Cl)c2)cc1.Cl |
| InChI | InChI=1S/C24H35ClN2O.ClH/c1-19(27-18-24(28)22-9-7-10-23(25)17-22)16-21-13-11-20(12-14-21)8-5-3-4-6-15-26-2;/h7,9-14,17,19,24,26-28H,3-6,8,15-16,18H2,1-2H3;1H |
| InChIKey | ACTMGUORKYEDPF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|