About N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride
N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride (PubChem CID 44522796) has the molecular formula C17H21ClN4
and a molecular weight of 316.84 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride |
| PubChem CID | 44522796 |
| Molecular Formula | C17H21ClN4 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride |
| SMILES | Cc1cc(Nc2ccc(C(C)(C)C)cc2)c2[nH]ncc2n1.Cl |
| InChI | InChI=1S/C17H20N4.ClH/c1-11-9-14(16-15(19-11)10-18-21-16)20-13-7-5-12(6-8-13)17(2,3)4;/h5-10H,1-4H3,(H,18,21)(H,19,20);1H |
| InChIKey | OJBIHMADTLIGFL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride?
The IUPAC name of N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride (CID 44522796) is N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride.
What is the SMILES notation for N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride?
The canonical SMILES for N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride is Cc1cc(Nc2ccc(C(C)(C)C)cc2)c2[nH]ncc2n1.Cl.
What is the InChIKey of N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride?
The InChIKey is OJBIHMADTLIGFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4.ClH/c1-11-9-14(16-15(19-11)10-18-21-16)20-13-7-5-12(6-8-13)17(2,3)4;/h5-10H,1-4H3,(H,18,21)(H,19,20);1H.
What are the key properties of N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride?
N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride has a molecular weight of 316.84 g/mol, XLogP of 4.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butylphenyl)-5-methyl-1H-pyrazolo[4,3-b]pyridin-7-amine;hydrochloride is sourced from PubChem (CID 44522796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).