C19H31ClN2 — CID 44522821
N,N-dibutyl-5,6,7,8-tetrahydronaphthalene-1-carboximidamide;hydrochloride (PubChem CID 44522821) has the molecular formula C19H31ClN2 and a molecular weight of 322.92 g/mol. Its IUPAC name is N,N-dibutyl-5,6,7,8-tetrahydronaphthalene-1-carboximidamide;hydrochloride.
| Compound Name | N,N-dibutyl-5,6,7,8-tetrahydronaphthalene-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 44522821 |
| Molecular Formula | C19H31ClN2 |
| Molecular Weight | 322.92 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | N,N-dibutyl-5,6,7,8-tetrahydronaphthalene-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(/c1cccc2c1CCCC2)N(CCCC)CCCC |
| InChI | InChI=1S/C19H30N2.ClH/c1-3-5-14-21(15-6-4-2)19(20)18-13-9-11-16-10-7-8-12-17(16)18;/h9,11,13,20H,3-8,10,12,14-15H2,1-2H3;1H/b20-19-; |
| InChIKey | VTLNFHNNJLXHPX-BLTQDSCZSA-N |
| XLogP | 5.21 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.92 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|