C12H15Cl2N5O — CID 44522890
2-N-[(3,4-dichlorophenyl)methoxy]-4,4-dimethyl-1H-1,3,5-triazine-2,6-diamine (PubChem CID 44522890) has the molecular formula C12H15Cl2N5O and a molecular weight of 316.19 g/mol. Its IUPAC name is 2-N-[(3,4-dichlorophenyl)methoxy]-4,4-dimethyl-1H-1,3,5-triazine-2,6-diamine.
| Compound Name | 2-N-[(3,4-dichlorophenyl)methoxy]-4,4-dimethyl-1H-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 44522890 |
| Molecular Formula | C12H15Cl2N5O |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-N-[(3,4-dichlorophenyl)methoxy]-4,4-dimethyl-1H-1,3,5-triazine-2,6-diamine |
| SMILES | CC1(C)N=C(N)NC(NOCc2ccc(Cl)c(Cl)c2)=N1 |
| InChI | InChI=1S/C12H15Cl2N5O/c1-12(2)17-10(15)16-11(18-12)19-20-6-7-3-4-8(13)9(14)5-7/h3-5H,6H2,1-2H3,(H4,15,16,17,18,19) |
| InChIKey | GPSQOHWXPLXAAG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|