C20H38BrN5O — CID 44522900
5-(6-cyclohexylhexoxy)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine;hydrobromide (PubChem CID 44522900) has the molecular formula C20H38BrN5O and a molecular weight of 444.46 g/mol. Its IUPAC name is 5-(6-cyclohexylhexoxy)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine;hydrobromide.
| Compound Name | 5-(6-cyclohexylhexoxy)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine;hydrobromide |
|---|---|
| PubChem CID | 44522900 |
| Molecular Formula | C20H38BrN5O |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 5-(6-cyclohexylhexoxy)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine;hydrobromide |
| SMILES | Br.NC1=NC2(CCCCC2)N(OCCCCCCC2CCCCC2)C(N)=N1 |
| InChI | InChI=1S/C20H37N5O.BrH/c21-18-23-19(22)25(20(24-18)14-8-4-9-15-20)26-16-10-2-1-5-11-17-12-6-3-7-13-17;/h17H,1-16H2,(H4,21,22,23,24);1H |
| InChIKey | PNNHBVSQAVNEEE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|