C21H29BrClN5O2 — CID 44522928
1-[6-(4-chloronaphthalen-1-yl)oxyhexoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide (PubChem CID 44522928) has the molecular formula C21H29BrClN5O2 and a molecular weight of 498.85 g/mol. Its IUPAC name is 1-[6-(4-chloronaphthalen-1-yl)oxyhexoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide.
| Compound Name | 1-[6-(4-chloronaphthalen-1-yl)oxyhexoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide |
|---|---|
| PubChem CID | 44522928 |
| Molecular Formula | C21H29BrClN5O2 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 1-[6-(4-chloronaphthalen-1-yl)oxyhexoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide |
| SMILES | Br.CC1(C)N=C(N)N=C(N)N1OCCCCCCOc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C21H28ClN5O2.BrH/c1-21(2)26-19(23)25-20(24)27(21)29-14-8-4-3-7-13-28-18-12-11-17(22)15-9-5-6-10-16(15)18;/h5-6,9-12H,3-4,7-8,13-14H2,1-2H3,(H4,23,24,25,26);1H |
| InChIKey | PTUUAHJDXVSYHB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|