C10H11Cl2N5O — CID 44522979
1-[(3,4-dichlorophenyl)methoxy]-2H-1,3,5-triazine-4,6-diamine (PubChem CID 44522979) has the molecular formula C10H11Cl2N5O and a molecular weight of 288.14 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methoxy]-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 1-[(3,4-dichlorophenyl)methoxy]-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 44522979 |
| Molecular Formula | C10H11Cl2N5O |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methoxy]-2H-1,3,5-triazine-4,6-diamine |
| SMILES | NC1=NCN(OCc2ccc(Cl)c(Cl)c2)C(N)=N1 |
| InChI | InChI=1S/C10H11Cl2N5O/c11-7-2-1-6(3-8(7)12)4-18-17-5-15-9(13)16-10(17)14/h1-3H,4-5H2,(H4,13,14,15,16) |
| InChIKey | LBDZURXREPRBML-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |