About (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide
(1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide (PubChem CID 44522998) has the molecular formula C22H28BrNO3
and a molecular weight of 434.37 g/mol. Its IUPAC name is (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide.
Molecular Properties
| Compound Name | (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide |
| PubChem CID | 44522998 |
| Molecular Formula | C22H28BrNO3 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide |
| SMILES | Br.CCOC(C(=O)OCC1CCCN1C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3.BrH/c1-3-26-22(18-11-6-4-7-12-18,19-13-8-5-9-14-19)21(24)25-17-20-15-10-16-23(20)2;/h4-9,11-14,20H,3,10,15-17H2,1-2H3;1H |
| InChIKey | BHFXWHJCJHCSMD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide?
The IUPAC name of (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide (CID 44522998) is (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide.
What is the SMILES notation for (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide?
The canonical SMILES for (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide is Br.CCOC(C(=O)OCC1CCCN1C)(c1ccccc1)c1ccccc1.
What is the InChIKey of (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide?
The InChIKey is BHFXWHJCJHCSMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3.BrH/c1-3-26-22(18-11-6-4-7-12-18,19-13-8-5-9-14-19)21(24)25-17-20-15-10-16-23(20)2;/h4-9,11-14,20H,3,10,15-17H2,1-2H3;1H.
What are the key properties of (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide?
(1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide has a molecular weight of 434.37 g/mol, XLogP of 4.18, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrrolidin-2-yl)methyl 2-ethoxy-2,2-diphenylacetate;hydrobromide is sourced from PubChem (CID 44522998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).