About 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride
3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride (PubChem CID 44523004) has the molecular formula C8H9Br2ClN4
and a molecular weight of 356.45 g/mol. Its IUPAC name is 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride |
| PubChem CID | 44523004 |
| Molecular Formula | C8H9Br2ClN4 |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride |
| SMILES | Brc1cnc(NC2=NCCN2)c(Br)c1.Cl |
| InChI | InChI=1S/C8H8Br2N4.ClH/c9-5-3-6(10)7(13-4-5)14-8-11-1-2-12-8;/h3-4H,1-2H2,(H2,11,12,13,14);1H |
| InChIKey | NFPQNZPUZUNUNP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
The IUPAC name of 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride (CID 44523004) is 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride.
What is the SMILES notation for 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
The canonical SMILES for 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride is Brc1cnc(NC2=NCCN2)c(Br)c1.Cl.
What is the InChIKey of 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
The InChIKey is NFPQNZPUZUNUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2N4.ClH/c9-5-3-6(10)7(13-4-5)14-8-11-1-2-12-8;/h3-4H,1-2H2,(H2,11,12,13,14);1H.
What are the key properties of 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride has a molecular weight of 356.45 g/mol, XLogP of 2.40, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride is sourced from PubChem (CID 44523004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).