About (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride
(1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride (PubChem CID 44523072) has the molecular formula C24H32ClNO3
and a molecular weight of 417.98 g/mol. Its IUPAC name is (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride.
Molecular Properties
| Compound Name | (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride |
| PubChem CID | 44523072 |
| Molecular Formula | C24H32ClNO3 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride |
| SMILES | CCCCOC(C(=O)OCC1CCCN1C)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C24H31NO3.ClH/c1-3-4-18-28-24(20-12-7-5-8-13-20,21-14-9-6-10-15-21)23(26)27-19-22-16-11-17-25(22)2;/h5-10,12-15,22H,3-4,11,16-19H2,1-2H3;1H |
| InChIKey | LMZAZNPGRNNGHF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride?
The IUPAC name of (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride (CID 44523072) is (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride.
What is the SMILES notation for (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride?
The canonical SMILES for (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride is CCCCOC(C(=O)OCC1CCCN1C)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride?
The InChIKey is LMZAZNPGRNNGHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31NO3.ClH/c1-3-4-18-28-24(20-12-7-5-8-13-20,21-14-9-6-10-15-21)23(26)27-19-22-16-11-17-25(22)2;/h5-10,12-15,22H,3-4,11,16-19H2,1-2H3;1H.
What are the key properties of (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride?
(1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride has a molecular weight of 417.98 g/mol, XLogP of 4.81, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrrolidin-2-yl)methyl 2-butoxy-2,2-diphenylacetate;hydrochloride is sourced from PubChem (CID 44523072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).