About N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride
N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 44523097) has the molecular formula C7H11ClN4S
and a molecular weight of 218.71 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride |
| PubChem CID | 44523097 |
| Molecular Formula | C7H11ClN4S |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | Cc1csc(NC2=NCCN2)n1.Cl |
| InChI | InChI=1S/C7H10N4S.ClH/c1-5-4-12-7(10-5)11-6-8-2-3-9-6;/h4H,2-3H2,1H3,(H2,8,9,10,11);1H |
| InChIKey | UCZPGQPHBLHIJD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride (CID 44523097) is N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride is Cc1csc(NC2=NCCN2)n1.Cl.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride?
The InChIKey is UCZPGQPHBLHIJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4S.ClH/c1-5-4-12-7(10-5)11-6-8-2-3-9-6;/h4H,2-3H2,1H3,(H2,8,9,10,11);1H.
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride?
N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride has a molecular weight of 218.71 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride is sourced from PubChem (CID 44523097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).