About N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide
N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide (PubChem CID 44523130) has the molecular formula C12H14Cl2N2O2
and a molecular weight of 289.16 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide.
Molecular Properties
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide |
| PubChem CID | 44523130 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide |
| SMILES | CN(C)C(=O)CC(=O)NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O2/c1-16(2)12(18)6-11(17)15-7-8-9(13)4-3-5-10(8)14/h3-5H,6-7H2,1-2H3,(H,15,17) |
| InChIKey | JJDCCQPGYTYCRI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide?
The IUPAC name of N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide (CID 44523130) is N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide.
What is the SMILES notation for N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide?
The canonical SMILES for N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide is CN(C)C(=O)CC(=O)NCc1c(Cl)cccc1Cl.
What is the InChIKey of N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide?
The InChIKey is JJDCCQPGYTYCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2N2O2/c1-16(2)12(18)6-11(17)15-7-8-9(13)4-3-5-10(8)14/h3-5H,6-7H2,1-2H3,(H,15,17).
What are the key properties of N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide?
N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide has a molecular weight of 289.16 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,6-dichlorophenyl)methyl]-N',N'-dimethylpropanediamide is sourced from PubChem (CID 44523130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).