C12H15Cl4N5O2 — CID 44523150
6,6-dimethyl-1-[(2,4,5-trichlorophenoxy)methoxy]-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 44523150) has the molecular formula C12H15Cl4N5O2 and a molecular weight of 403.10 g/mol. Its IUPAC name is 6,6-dimethyl-1-[(2,4,5-trichlorophenoxy)methoxy]-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 6,6-dimethyl-1-[(2,4,5-trichlorophenoxy)methoxy]-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 44523150 |
| Molecular Formula | C12H15Cl4N5O2 |
| Molecular Weight | 403.10 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 6,6-dimethyl-1-[(2,4,5-trichlorophenoxy)methoxy]-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | CC1(C)N=C(N)N=C(N)N1OCOc1cc(Cl)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C12H14Cl3N5O2.ClH/c1-12(2)19-10(16)18-11(17)20(12)22-5-21-9-4-7(14)6(13)3-8(9)15;/h3-4H,5H2,1-2H3,(H4,16,17,18,19);1H |
| InChIKey | FNGUYTZXYCSFHY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.10 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|