About [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate
[2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate (PubChem CID 44523171) has the molecular formula C26H34N2O3
and a molecular weight of 422.57 g/mol. Its IUPAC name is [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate.
Molecular Properties
| Compound Name | [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate |
| PubChem CID | 44523171 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate |
| SMILES | CCCCCC(C)C(C)c1cc(OC(N)=O)c2c(c1)OC(C)(C)C=C2c1ccncc1 |
| InChI | InChI=1S/C26H34N2O3/c1-6-7-8-9-17(2)18(3)20-14-22(30-25(27)29)24-21(19-10-12-28-13-11-19)16-26(4,5)31-23(24)15-20/h10-18H,6-9H2,1-5H3,(H2,27,29) |
| InChIKey | QNQLTBALJDNJAP-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate?
The IUPAC name of [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate (CID 44523171) is [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate.
What is the SMILES notation for [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate?
The canonical SMILES for [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate is CCCCCC(C)C(C)c1cc(OC(N)=O)c2c(c1)OC(C)(C)C=C2c1ccncc1.
What is the InChIKey of [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate?
The InChIKey is QNQLTBALJDNJAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34N2O3/c1-6-7-8-9-17(2)18(3)20-14-22(30-25(27)29)24-21(19-10-12-28-13-11-19)16-26(4,5)31-23(24)15-20/h10-18H,6-9H2,1-5H3,(H2,27,29).
What are the key properties of [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate?
[2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate has a molecular weight of 422.57 g/mol, XLogP of 6.46, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-yl] carbamate is sourced from PubChem (CID 44523171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).