About 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine
8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine (PubChem CID 44523362) has the molecular formula C13H14N4O
and a molecular weight of 242.28 g/mol. Its IUPAC name is 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine.
Molecular Properties
| Compound Name | 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine |
| PubChem CID | 44523362 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine |
| SMILES | CC(C)c1cc2c(ccc3nc(N)nc(N)c32)o1 |
| InChI | InChI=1S/C13H14N4O/c1-6(2)10-5-7-9(18-10)4-3-8-11(7)12(14)17-13(15)16-8/h3-6H,1-2H3,(H4,14,15,16,17) |
| InChIKey | GRVXIGBRVPMDKY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine?
The IUPAC name of 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine (CID 44523362) is 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine.
What is the SMILES notation for 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine?
The canonical SMILES for 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine is CC(C)c1cc2c(ccc3nc(N)nc(N)c32)o1.
What is the InChIKey of 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine?
The InChIKey is GRVXIGBRVPMDKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O/c1-6(2)10-5-7-9(18-10)4-3-8-11(7)12(14)17-13(15)16-8/h3-6H,1-2H3,(H4,14,15,16,17).
What are the key properties of 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine?
8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine has a molecular weight of 242.28 g/mol, XLogP of 2.66, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propan-2-ylfuro[3,2-f]quinazoline-1,3-diamine is sourced from PubChem (CID 44523362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).