C34H38O6S3 — CID 44523385
[(2S,3S,5R,6S)-3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate (PubChem CID 44523385) has the molecular formula C34H38O6S3 and a molecular weight of 638.87 g/mol. Its IUPAC name is [(2S,3S,5R,6S)-3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate.
| Compound Name | [(2S,3S,5R,6S)-3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate |
|---|---|
| PubChem CID | 44523385 |
| Molecular Formula | C34H38O6S3 |
| Molecular Weight | 638.87 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | [(2S,3S,5R,6S)-3,5-dibenzoyloxy-2,6-bis(tert-butylsulfanyl)thian-4-yl] benzoate |
| SMILES | CC(C)(C)S[C@H]1S[C@H](SC(C)(C)C)[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H38O6S3/c1-33(2,3)42-31-26(39-29(36)23-18-12-8-13-19-23)25(38-28(35)22-16-10-7-11-17-22)27(32(41-31)43-34(4,5)6)40-30(37)24-20-14-9-15-21-24/h7-21,25-27,31-32H,1-6H3/t25?,26-,27+,31-,32-/m1/s1 |
| InChIKey | BFQBOAFRFJDINI-DREVVNGRSA-N |
| XLogP | 8.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.87 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|