C17H21N5O2 — CID 44523414
N',N'-diethyl-N-(6-nitro-9H-pyrido[2,3-b]indol-4-yl)ethane-1,2-diamine (PubChem CID 44523414) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N',N'-diethyl-N-(6-nitro-9H-pyrido[2,3-b]indol-4-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(6-nitro-9H-pyrido[2,3-b]indol-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 44523414 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N',N'-diethyl-N-(6-nitro-9H-pyrido[2,3-b]indol-4-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccnc2[nH]c3ccc([N+](=O)[O-])cc3c12 |
| InChI | InChI=1S/C17H21N5O2/c1-3-21(4-2)10-9-18-15-7-8-19-17-16(15)13-11-12(22(23)24)5-6-14(13)20-17/h5-8,11H,3-4,9-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | IKZLKTALESMFOO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|