C27H38N2O6 — CID 44523470
benzyl (2R,3S)-2-[(2R)-1-ethoxy-1-oxopent-4-en-2-yl]-3-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]pyrrolidine-1-carboxylate (PubChem CID 44523470) has the molecular formula C27H38N2O6 and a molecular weight of 486.61 g/mol. Its IUPAC name is benzyl (2R,3S)-2-[(2R)-1-ethoxy-1-oxopent-4-en-2-yl]-3-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-2-[(2R)-1-ethoxy-1-oxopent-4-en-2-yl]-3-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 44523470 |
| Molecular Formula | C27H38N2O6 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | benzyl (2R,3S)-2-[(2R)-1-ethoxy-1-oxopent-4-en-2-yl]-3-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]pyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H](C(=O)OCC)[C@@H]1[C@@H](N(CC=C)C(=O)OC(C)(C)C)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H38N2O6/c1-7-13-21(24(30)33-9-3)23-22(28(17-8-2)26(32)35-27(4,5)6)16-18-29(23)25(31)34-19-20-14-11-10-12-15-20/h7-8,10-12,14-15,21-23H,1-2,9,13,16-19H2,3-6H3/t21-,22+,23-/m1/s1 |
| InChIKey | LVKUXZKGUVFYSD-XPWALMASSA-N |
| XLogP | 4.94 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|