About 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol
8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol (PubChem CID 44523491) has the molecular formula C24H20N2O
and a molecular weight of 352.44 g/mol. Its IUPAC name is 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol.
Molecular Properties
| Compound Name | 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol |
| PubChem CID | 44523491 |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol |
| SMILES | Cc1c2ccncc2c(C)c2c1[nH]c1cc(Cc3ccccc3)c(O)cc12 |
| InChI | InChI=1S/C24H20N2O/c1-14-20-13-25-9-8-18(20)15(2)24-23(14)19-12-22(27)17(11-21(19)26-24)10-16-6-4-3-5-7-16/h3-9,11-13,26-27H,10H2,1-2H3 |
| InChIKey | SPYGFWIDPZNNNG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol?
The IUPAC name of 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol (CID 44523491) is 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol.
What is the SMILES notation for 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol?
The canonical SMILES for 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol is Cc1c2ccncc2c(C)c2c1[nH]c1cc(Cc3ccccc3)c(O)cc12.
What is the InChIKey of 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol?
The InChIKey is SPYGFWIDPZNNNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O/c1-14-20-13-25-9-8-18(20)15(2)24-23(14)19-12-22(27)17(11-21(19)26-24)10-16-6-4-3-5-7-16/h3-9,11-13,26-27H,10H2,1-2H3.
What are the key properties of 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol?
8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol has a molecular weight of 352.44 g/mol, XLogP of 5.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol is sourced from PubChem (CID 44523491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).