C52H54N8O6 — CID 44523496
butanedioic acid;bis(3-[2-(dimethylamino)ethyl]-N-(4-pyridin-4-ylphenyl)-1H-indole-5-carboxamide) (PubChem CID 44523496) has the molecular formula C52H54N8O6 and a molecular weight of 887.05 g/mol. Its IUPAC name is butanedioic acid;bis(3-[2-(dimethylamino)ethyl]-N-(4-pyridin-4-ylphenyl)-1H-indole-5-carboxamide).
| Compound Name | butanedioic acid;bis(3-[2-(dimethylamino)ethyl]-N-(4-pyridin-4-ylphenyl)-1H-indole-5-carboxamide) |
|---|---|
| PubChem CID | 44523496 |
| Molecular Formula | C52H54N8O6 |
| Molecular Weight | 887.05 g/mol |
| Exact Mass | 886.42 |
| IUPAC Name | butanedioic acid;bis(3-[2-(dimethylamino)ethyl]-N-(4-pyridin-4-ylphenyl)-1H-indole-5-carboxamide) |
| SMILES | CN(C)CCc1c[nH]c2ccc(C(=O)Nc3ccc(-c4ccncc4)cc3)cc12.CN(C)CCc1c[nH]c2ccc(C(=O)Nc3ccc(-c4ccncc4)cc3)cc12.O=C(O)CCC(=O)O |
| InChI | InChI=1S/2C24H24N4O.C4H6O4/c2*1-28(2)14-11-20-16-26-23-8-5-19(15-22(20)23)24(29)27-21-6-3-17(4-7-21)18-9-12-25-13-10-18;5-3(6)1-2-4(7)8/h2*3-10,12-13,15-16,26H,11,14H2,1-2H3,(H,27,29);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | PKPSIKZXSWVWGP-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 196.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.05 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |