C33H34N2O7 — CID 44523548
(E)-but-2-enedioic acid;N-[4-[2-(diethylamino)ethoxy]phenyl]-3-(2-phenylethenyl)-1-benzofuran-2-carboxamide (PubChem CID 44523548) has the molecular formula C33H34N2O7 and a molecular weight of 570.64 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[4-[2-(diethylamino)ethoxy]phenyl]-3-(2-phenylethenyl)-1-benzofuran-2-carboxamide.
| Compound Name | (E)-but-2-enedioic acid;N-[4-[2-(diethylamino)ethoxy]phenyl]-3-(2-phenylethenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 44523548 |
| Molecular Formula | C33H34N2O7 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[4-[2-(diethylamino)ethoxy]phenyl]-3-(2-phenylethenyl)-1-benzofuran-2-carboxamide |
| SMILES | CCN(CC)CCOc1ccc(NC(=O)c2oc3ccccc3c2C=Cc2ccccc2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C29H30N2O3.C4H4O4/c1-3-31(4-2)20-21-33-24-17-15-23(16-18-24)30-29(32)28-26(19-14-22-10-6-5-7-11-22)25-12-8-9-13-27(25)34-28;5-3(6)1-2-4(7)8/h5-19H,3-4,20-21H2,1-2H3,(H,30,32);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | NHYQOMQEVADDND-WLHGVMLRSA-N |
| XLogP | 6.29 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|