C22H24ClF2N3 — CID 44523564
(3R)-4-(3,4-difluorophenyl)-1-N-[(4-pyridin-3-ylphenyl)methyl]butane-1,3-diamine;hydrochloride (PubChem CID 44523564) has the molecular formula C22H24ClF2N3 and a molecular weight of 403.90 g/mol. Its IUPAC name is (3R)-4-(3,4-difluorophenyl)-1-N-[(4-pyridin-3-ylphenyl)methyl]butane-1,3-diamine;hydrochloride.
| Compound Name | (3R)-4-(3,4-difluorophenyl)-1-N-[(4-pyridin-3-ylphenyl)methyl]butane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 44523564 |
| Molecular Formula | C22H24ClF2N3 |
| Molecular Weight | 403.90 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (3R)-4-(3,4-difluorophenyl)-1-N-[(4-pyridin-3-ylphenyl)methyl]butane-1,3-diamine;hydrochloride |
| SMILES | Cl.N[C@@H](CCNCc1ccc(-c2cccnc2)cc1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H23F2N3.ClH/c23-21-8-5-17(13-22(21)24)12-20(25)9-11-27-14-16-3-6-18(7-4-16)19-2-1-10-26-15-19;/h1-8,10,13,15,20,27H,9,11-12,14,25H2;1H/t20-;/m0./s1 |
| InChIKey | NUSLLBWVDJTBJY-BDQAORGHSA-N |
| XLogP | 4.50 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|