About 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride
7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride (PubChem CID 44523613) has the molecular formula C18H18BrClN2
and a molecular weight of 377.71 g/mol. Its IUPAC name is 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride |
| PubChem CID | 44523613 |
| Molecular Formula | C18H18BrClN2 |
| Molecular Weight | 377.71 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride |
| SMILES | Cc1cccc(C)c1CNc1ccnc2cc(Br)ccc12.Cl |
| InChI | InChI=1S/C18H17BrN2.ClH/c1-12-4-3-5-13(2)16(12)11-21-17-8-9-20-18-10-14(19)6-7-15(17)18;/h3-10H,11H2,1-2H3,(H,20,21);1H |
| InChIKey | RKTRDLYSUJZQKU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.71 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride?
The IUPAC name of 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride (CID 44523613) is 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride.
What is the SMILES notation for 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride?
The canonical SMILES for 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride is Cc1cccc(C)c1CNc1ccnc2cc(Br)ccc12.Cl.
What is the InChIKey of 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride?
The InChIKey is RKTRDLYSUJZQKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrN2.ClH/c1-12-4-3-5-13(2)16(12)11-21-17-8-9-20-18-10-14(19)6-7-15(17)18;/h3-10H,11H2,1-2H3,(H,20,21);1H.
What are the key properties of 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride?
7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride has a molecular weight of 377.71 g/mol, XLogP of 5.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-N-[(2,6-dimethylphenyl)methyl]quinolin-4-amine;hydrochloride is sourced from PubChem (CID 44523613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).