About 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide
3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide (PubChem CID 44523646) has the molecular formula C27H19FN4O2
and a molecular weight of 450.47 g/mol. Its IUPAC name is 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide |
| PubChem CID | 44523646 |
| Molecular Formula | C27H19FN4O2 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(=O)Nc2cccc(-c3cccc(-c4nc5ccc(F)cc5[nH]4)c3)c2)c1 |
| InChI | InChI=1S/C27H19FN4O2/c28-21-10-11-23-24(15-21)32-26(31-23)19-7-1-4-16(12-19)17-5-3-9-22(14-17)30-27(34)20-8-2-6-18(13-20)25(29)33/h1-15H,(H2,29,33)(H,30,34)(H,31,32) |
| InChIKey | ZGNZWPILEBLZDH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide?
The IUPAC name of 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide (CID 44523646) is 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide.
What is the SMILES notation for 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide?
The canonical SMILES for 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide is NC(=O)c1cccc(C(=O)Nc2cccc(-c3cccc(-c4nc5ccc(F)cc5[nH]4)c3)c2)c1.
What is the InChIKey of 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide?
The InChIKey is ZGNZWPILEBLZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19FN4O2/c28-21-10-11-23-24(15-21)32-26(31-23)19-7-1-4-16(12-19)17-5-3-9-22(14-17)30-27(34)20-8-2-6-18(13-20)25(29)33/h1-15H,(H2,29,33)(H,30,34)(H,31,32).
What are the key properties of 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide?
3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide has a molecular weight of 450.47 g/mol, XLogP of 5.39, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]benzene-1,3-dicarboxamide is sourced from PubChem (CID 44523646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).