C24H24N4O — CID 44523659
2-amino-5,5-diphenyl-3-(4-pyridin-2-ylbutyl)imidazol-4-one (PubChem CID 44523659) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-amino-5,5-diphenyl-3-(4-pyridin-2-ylbutyl)imidazol-4-one.
| Compound Name | 2-amino-5,5-diphenyl-3-(4-pyridin-2-ylbutyl)imidazol-4-one |
|---|---|
| PubChem CID | 44523659 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-amino-5,5-diphenyl-3-(4-pyridin-2-ylbutyl)imidazol-4-one |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1CCCCc1ccccn1 |
| InChI | InChI=1S/C24H24N4O/c25-23-27-24(19-11-3-1-4-12-19,20-13-5-2-6-14-20)22(29)28(23)18-10-8-16-21-15-7-9-17-26-21/h1-7,9,11-15,17H,8,10,16,18H2,(H2,25,27) |
| InChIKey | NMFFGVFJFHJARV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|