C25H26N4OS — CID 44523856
4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 44523856) has the molecular formula C25H26N4OS and a molecular weight of 430.58 g/mol. Its IUPAC name is 4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 44523856 |
| Molecular Formula | C25H26N4OS |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | Cc1cccc2[nH]c(-c3ccc(-c4ccc(C(=O)NCCN5CCCC5)cc4)s3)nc12 |
| InChI | InChI=1S/C25H26N4OS/c1-17-5-4-6-20-23(17)28-24(27-20)22-12-11-21(31-22)18-7-9-19(10-8-18)25(30)26-13-16-29-14-2-3-15-29/h4-12H,2-3,13-16H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | ACVDOWGKYSRWPG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |