About 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide
3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide (PubChem CID 44523949) has the molecular formula C25H18N4O2S
and a molecular weight of 438.51 g/mol. Its IUPAC name is 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide |
| PubChem CID | 44523949 |
| Molecular Formula | C25H18N4O2S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(=O)Nc2cccc(-c3csc(-c4nc5ccccc5[nH]4)c3)c2)c1 |
| InChI | InChI=1S/C25H18N4O2S/c26-23(30)16-6-3-7-17(11-16)25(31)27-19-8-4-5-15(12-19)18-13-22(32-14-18)24-28-20-9-1-2-10-21(20)29-24/h1-14H,(H2,26,30)(H,27,31)(H,28,29) |
| InChIKey | HEVMNCVQBFNGSS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide?
The IUPAC name of 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide (CID 44523949) is 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide.
What is the SMILES notation for 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide?
The canonical SMILES for 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide is NC(=O)c1cccc(C(=O)Nc2cccc(-c3csc(-c4nc5ccccc5[nH]4)c3)c2)c1.
What is the InChIKey of 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide?
The InChIKey is HEVMNCVQBFNGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18N4O2S/c26-23(30)16-6-3-7-17(11-16)25(31)27-19-8-4-5-15(12-19)18-13-22(32-14-18)24-28-20-9-1-2-10-21(20)29-24/h1-14H,(H2,26,30)(H,27,31)(H,28,29).
What are the key properties of 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide?
3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide has a molecular weight of 438.51 g/mol, XLogP of 5.31, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]benzene-1,3-dicarboxamide is sourced from PubChem (CID 44523949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).