C31H28F3N3O4S — CID 44524214
N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-(4-methylsulfonylphenyl)ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 44524214) has the molecular formula C31H28F3N3O4S and a molecular weight of 595.64 g/mol. Its IUPAC name is N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-(4-methylsulfonylphenyl)ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-(4-methylsulfonylphenyl)ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44524214 |
| Molecular Formula | C31H28F3N3O4S |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-(4-methylsulfonylphenyl)ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)c1ccc(CCNCc2ccc(-c3cccc(-c4nc5ccccc5[nH]4)c3)cc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H27N3O2S.C2HF3O2/c1-35(33,34)26-15-11-21(12-16-26)17-18-30-20-22-9-13-23(14-10-22)24-5-4-6-25(19-24)29-31-27-7-2-3-8-28(27)32-29;3-2(4,5)1(6)7/h2-16,19,30H,17-18,20H2,1H3,(H,31,32);(H,6,7) |
| InChIKey | MYHSKDQHAPRIJB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|