C32H26F4N4O2 — CID 44524244
N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 44524244) has the molecular formula C32H26F4N4O2 and a molecular weight of 574.58 g/mol. Its IUPAC name is N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44524244 |
| Molecular Formula | C32H26F4N4O2 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | N-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | Fc1ccc2[nH]cc(CCNCc3ccc(-c4cccc(-c5nc6ccccc6[nH]5)c4)cc3)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H25FN4.C2HF3O2/c31-25-12-13-27-26(17-25)24(19-33-27)14-15-32-18-20-8-10-21(11-9-20)22-4-3-5-23(16-22)30-34-28-6-1-2-7-29(28)35-30;3-2(4,5)1(6)7/h1-13,16-17,19,32-33H,14-15,18H2,(H,34,35);(H,6,7) |
| InChIKey | LMMSFPDYJCEWKQ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|