C26H28N4OS — CID 44524598
1-[3-[[4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]methylamino]propyl]pyrrolidin-2-one (PubChem CID 44524598) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is 1-[3-[[4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 44524598 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-[3-[[4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]methylamino]propyl]pyrrolidin-2-one |
| SMILES | Cc1cccc2[nH]c(-c3ccc(-c4ccc(CNCCCN5CCCC5=O)cc4)s3)nc12 |
| InChI | InChI=1S/C26H28N4OS/c1-18-5-2-6-21-25(18)29-26(28-21)23-13-12-22(32-23)20-10-8-19(9-11-20)17-27-14-4-16-30-15-3-7-24(30)31/h2,5-6,8-13,27H,3-4,7,14-17H2,1H3,(H,28,29) |
| InChIKey | LGDIRLCUNFEYJF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|