C30H27F3N4O2 — CID 44524765
N-[[3-[4-(4-methyl-1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-pyridin-4-ylethanamine;2,2,2-trifluoroacetic acid (PubChem CID 44524765) has the molecular formula C30H27F3N4O2 and a molecular weight of 532.57 g/mol. Its IUPAC name is N-[[3-[4-(4-methyl-1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-pyridin-4-ylethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[3-[4-(4-methyl-1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-pyridin-4-ylethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44524765 |
| Molecular Formula | C30H27F3N4O2 |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-[[3-[4-(4-methyl-1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-2-pyridin-4-ylethanamine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cccc2[nH]c(-c3ccc(-c4cccc(CNCCc5ccncc5)c4)cc3)nc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H26N4.C2HF3O2/c1-20-4-2-7-26-27(20)32-28(31-26)24-10-8-23(9-11-24)25-6-3-5-22(18-25)19-30-17-14-21-12-15-29-16-13-21;3-2(4,5)1(6)7/h2-13,15-16,18,30H,14,17,19H2,1H3,(H,31,32);(H,6,7) |
| InChIKey | XVSJPEBJYXOYMH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|