C32H43N3O3 — CID 44524826
tert-butyl 1-[methyl-[4-[[(E)-3-phenylprop-2-enoyl]amino]butyl]amino]spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate (PubChem CID 44524826) has the molecular formula C32H43N3O3 and a molecular weight of 517.71 g/mol. Its IUPAC name is tert-butyl 1-[methyl-[4-[[(E)-3-phenylprop-2-enoyl]amino]butyl]amino]spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 1-[methyl-[4-[[(E)-3-phenylprop-2-enoyl]amino]butyl]amino]spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 44524826 |
| Molecular Formula | C32H43N3O3 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | tert-butyl 1-[methyl-[4-[[(E)-3-phenylprop-2-enoyl]amino]butyl]amino]spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate |
| SMILES | CN(CCCCNC(=O)/C=C/c1ccccc1)C1CC2(CCN(C(=O)OC(C)(C)C)CC2)c2ccccc21 |
| InChI | InChI=1S/C32H43N3O3/c1-31(2,3)38-30(37)35-22-18-32(19-23-35)24-28(26-14-8-9-15-27(26)32)34(4)21-11-10-20-33-29(36)17-16-25-12-6-5-7-13-25/h5-9,12-17,28H,10-11,18-24H2,1-4H3,(H,33,36)/b17-16+ |
| InChIKey | RGKGGKGWUIXRDX-WUKNDPDISA-N |
| XLogP | 5.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|