C27H29F3N2O4S — CID 44525180
5-[3-[(2-methylpyrrolidin-1-yl)methyl]phenyl]-N-(2-phenoxyethyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44525180) has the molecular formula C27H29F3N2O4S and a molecular weight of 534.60 g/mol. Its IUPAC name is 5-[3-[(2-methylpyrrolidin-1-yl)methyl]phenyl]-N-(2-phenoxyethyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[3-[(2-methylpyrrolidin-1-yl)methyl]phenyl]-N-(2-phenoxyethyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44525180 |
| Molecular Formula | C27H29F3N2O4S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 5-[3-[(2-methylpyrrolidin-1-yl)methyl]phenyl]-N-(2-phenoxyethyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCCN1Cc1cccc(-c2ccc(C(=O)NCCOc3ccccc3)s2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28N2O2S.C2HF3O2/c1-19-7-6-15-27(19)18-20-8-5-9-21(17-20)23-12-13-24(30-23)25(28)26-14-16-29-22-10-3-2-4-11-22;3-2(4,5)1(6)7/h2-5,8-13,17,19H,6-7,14-16,18H2,1H3,(H,26,28);(H,6,7) |
| InChIKey | FSSJAKFFCUAHPE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|